RESUMO
The title compound, [Cu(3)(C(3)H(5)O(2))(6)(C(6)H(7)NO)(4)](n), is composed of polymeric chains formed by alternating centrosymmetric Cu(2)(mu-CH(3)CH(2)CO(2))(4) and Cu(C(3)H(5)O(2))(2)(C(6)H(7)NO)(2) units. These elemental units are linked by two bridging 3-pyridylmethanol (3PM) ligands. The Cu(2)(mu-CH(3)CH(2)CO(2))(4) group presents a centrosymmetric tetrabridged structure with four syn-syn bridging propionate ligands to which two 3PM molecules are bonded (through N), occupying the apical positions of each square-pyramidal polyhedron around the Cu(II) ions. The remaining mononuclear group is centred around a third Cu(II) ion, which lies on a symmetry centre and is bound to two monodentate propionate groups (through O), two monodentate 3PM molecules (through N) and two bridging 3PM molecules (through O), thus completing a square-bipyramidal CuO(2)N(2)O(2) coordination.